![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| wlef/ | 2024-01-01 20:12 | - | |
| wetland/ | 2015-09-17 13:47 | - | |
| wcreek-raw/ | 2024-01-02 22:02 | - | |
| uploads/ | 2019-11-12 08:13 | - | |
| synthesis/ | 2009-01-30 13:10 | - | |
| sylvania-raw/ | 2023-12-29 13:56 | - | |
| superior/ | 2010-01-12 08:40 | - | |
| snowcover/ | 2020-01-22 14:47 | - | |
| sipnet.zip | 2008-07-23 16:11 | 7.5M | |
| sipnet-cheas/ | 2010-02-01 10:54 | - | |
| potato/ | 2022-12-20 13:26 | - | |
| pines/ | 2022-12-20 13:26 | - | |
| picarro/ | 2014-09-29 15:43 | - | |
| pecan/ | 2017-03-24 07:58 | - | |
| nasa_roving/ | 2008-12-05 10:15 | - | |
| mime.types | 2009-04-29 15:39 | 8.3K | |
| mendota_buoy/ | 2022-04-14 10:38 | - | |
| logs/ | 2018-09-21 11:21 | - | |
| lcreek-raw/ | 2024-01-02 21:05 | - | |
| lakeflux/ | 2021-05-05 10:11 | - | |
| kxu/ | 2020-08-18 11:57 | - | |
| gapfill/ | 2009-02-09 09:54 | - | |
| docs/ | 2008-01-04 10:39 | - | |
| code/ | 2020-12-22 09:59 | - | |
| cheas/ | 2022-04-12 09:49 | - | |
| aoss/ | 2015-04-21 15:43 | - | |
| agrovoltaics/ | 2024-01-01 22:40 | - | |
| acme07/ | 2007-11-14 08:02 | - | |
| US-DFC/ | 2024-05-01 00:00 | - | |
| RIG/ | 2022-10-18 13:58 | - | |
| MANDIFORE/ | 2023-04-16 17:45 | - | |
| LakeMendota/ | 2016-09-21 06:10 | - | |
| Kernza/ | 2024-04-30 20:36 | - | |
| CHEESEHEAD-incoming/ | 2023-05-30 09:33 | - | |
| Allequash/ | 2023-12-29 13:57 | - | |
**PLEASE NOTE**
Permission to download this data does not grant permission to use the information contained in that file for publication. Please contact the owner of the file or the appropriate faculty member before use of any such information in a publication.